C13H13Cl2NO3 — CID 62627392
N-cyclopropyl-3-(2,4-dichloro-6-formylphenoxy)propanamide (PubChem CID 62627392) has the molecular formula C13H13Cl2NO3 and a molecular weight of 302.16 g/mol. Its IUPAC name is N-cyclopropyl-3-(2,4-dichloro-6-formylphenoxy)propanamide.
| Compound Name | N-cyclopropyl-3-(2,4-dichloro-6-formylphenoxy)propanamide |
|---|---|
| PubChem CID | 62627392 |
| Molecular Formula | C13H13Cl2NO3 |
| Molecular Weight | 302.16 g/mol |
| Exact Mass | 301.03 |
| IUPAC Name | N-cyclopropyl-3-(2,4-dichloro-6-formylphenoxy)propanamide |
| SMILES | O=Cc1cc(Cl)cc(Cl)c1OCCC(=O)NC1CC1 |
| InChI | InChI=1S/C13H13Cl2NO3/c14-9-5-8(7-17)13(11(15)6-9)19-4-3-12(18)16-10-1-2-10/h5-7,10H,1-4H2,(H,16,18) |
| InChIKey | HPVWTCSKZSEJTD-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.16 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|