C15H7Cl2F3O4 — CID 91730376
(2,4-dichloro-6-formylphenyl) 2,4,5-trifluoro-3-methoxybenzoate (PubChem CID 91730376) has the molecular formula C15H7Cl2F3O4 and a molecular weight of 379.12 g/mol. Its IUPAC name is (2,4-dichloro-6-formylphenyl) 2,4,5-trifluoro-3-methoxybenzoate.
| Compound Name | (2,4-dichloro-6-formylphenyl) 2,4,5-trifluoro-3-methoxybenzoate |
|---|---|
| PubChem CID | 91730376 |
| Molecular Formula | C15H7Cl2F3O4 |
| Molecular Weight | 379.12 g/mol |
| Exact Mass | 377.97 |
| IUPAC Name | (2,4-dichloro-6-formylphenyl) 2,4,5-trifluoro-3-methoxybenzoate |
| SMILES | COc1c(F)c(F)cc(C(=O)Oc2c(Cl)cc(Cl)cc2C=O)c1F |
| InChI | InChI=1S/C15H7Cl2F3O4/c1-23-14-11(19)8(4-10(18)12(14)20)15(22)24-13-6(5-21)2-7(16)3-9(13)17/h2-5H,1H3 |
| InChIKey | JUKZNTBHZNZYQM-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.12 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|