C18H10F6O6 — CID 153252588
[(E)-2-(2,4,5-trifluoro-3-methoxybenzoyl)oxyethenyl] 2,4,5-trifluoro-3-methoxybenzoate (PubChem CID 153252588) has the molecular formula C18H10F6O6 and a molecular weight of 436.26 g/mol. Its IUPAC name is [(E)-2-(2,4,5-trifluoro-3-methoxybenzoyl)oxyethenyl] 2,4,5-trifluoro-3-methoxybenzoate.
| Compound Name | [(E)-2-(2,4,5-trifluoro-3-methoxybenzoyl)oxyethenyl] 2,4,5-trifluoro-3-methoxybenzoate |
|---|---|
| PubChem CID | 153252588 |
| Molecular Formula | C18H10F6O6 |
| Molecular Weight | 436.26 g/mol |
| Exact Mass | 436.04 |
| IUPAC Name | [(E)-2-(2,4,5-trifluoro-3-methoxybenzoyl)oxyethenyl] 2,4,5-trifluoro-3-methoxybenzoate |
| SMILES | COc1c(F)c(F)cc(C(=O)O/C=C/OC(=O)c2cc(F)c(F)c(OC)c2F)c1F |
| InChI | InChI=1S/C18H10F6O6/c1-27-15-11(21)7(5-9(19)13(15)23)17(25)29-3-4-30-18(26)8-6-10(20)14(24)16(28-2)12(8)22/h3-6H,1-2H3/b4-3+ |
| InChIKey | WTQAOFLUJKJFFR-ONEGZZNKSA-N |
| XLogP | 4.02 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.26 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|