C11H10F3NO2 — CID 141049303
(2-aminocyclopropyl)-(2,4,5-trifluoro-3-methoxyphenyl)methanone (PubChem CID 141049303) has the molecular formula C11H10F3NO2 and a molecular weight of 245.20 g/mol. Its IUPAC name is (2-aminocyclopropyl)-(2,4,5-trifluoro-3-methoxyphenyl)methanone.
| Compound Name | (2-aminocyclopropyl)-(2,4,5-trifluoro-3-methoxyphenyl)methanone |
|---|---|
| PubChem CID | 141049303 |
| Molecular Formula | C11H10F3NO2 |
| Molecular Weight | 245.20 g/mol |
| Exact Mass | 245.07 |
| IUPAC Name | (2-aminocyclopropyl)-(2,4,5-trifluoro-3-methoxyphenyl)methanone |
| SMILES | COc1c(F)c(F)cc(C(=O)C2CC2N)c1F |
| InChI | InChI=1S/C11H10F3NO2/c1-17-11-8(13)5(2-6(12)9(11)14)10(16)4-3-7(4)15/h2,4,7H,3,15H2,1H3 |
| InChIKey | UBVXKVXLJAWGBS-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.20 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|