C14H9BrF3NO2 — CID 91730460
N-(4-bromophenyl)-2,4,5-trifluoro-3-methoxybenzamide (PubChem CID 91730460) has the molecular formula C14H9BrF3NO2 and a molecular weight of 360.13 g/mol. Its IUPAC name is N-(4-bromophenyl)-2,4,5-trifluoro-3-methoxybenzamide.
| Compound Name | N-(4-bromophenyl)-2,4,5-trifluoro-3-methoxybenzamide |
|---|---|
| PubChem CID | 91730460 |
| Molecular Formula | C14H9BrF3NO2 |
| Molecular Weight | 360.13 g/mol |
| Exact Mass | 358.98 |
| IUPAC Name | N-(4-bromophenyl)-2,4,5-trifluoro-3-methoxybenzamide |
| SMILES | COc1c(F)c(F)cc(C(=O)Nc2ccc(Br)cc2)c1F |
| InChI | InChI=1S/C14H9BrF3NO2/c1-21-13-11(17)9(6-10(16)12(13)18)14(20)19-8-4-2-7(15)3-5-8/h2-6H,1H3,(H,19,20) |
| InChIKey | JIZGNYVSUYKYAF-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.13 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|