C15H11F4NO3 — CID 7960826
N-(3,5-dimethoxyphenyl)-2,3,4,5-tetrafluorobenzamide (PubChem CID 7960826) has the molecular formula C15H11F4NO3 and a molecular weight of 329.25 g/mol. Its IUPAC name is N-(3,5-dimethoxyphenyl)-2,3,4,5-tetrafluorobenzamide.
| Compound Name | N-(3,5-dimethoxyphenyl)-2,3,4,5-tetrafluorobenzamide |
|---|---|
| PubChem CID | 7960826 |
| Molecular Formula | C15H11F4NO3 |
| Molecular Weight | 329.25 g/mol |
| Exact Mass | 329.07 |
| IUPAC Name | N-(3,5-dimethoxyphenyl)-2,3,4,5-tetrafluorobenzamide |
| SMILES | COc1cc(NC(=O)c2cc(F)c(F)c(F)c2F)cc(OC)c1 |
| InChI | InChI=1S/C15H11F4NO3/c1-22-8-3-7(4-9(5-8)23-2)20-15(21)10-6-11(16)13(18)14(19)12(10)17/h3-6H,1-2H3,(H,20,21) |
| InChIKey | LZSWWKUXBQLYME-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.25 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|