C13H11Cl2NO3S — CID 30272266
2,5-dichloro-N-(3,5-dimethoxyphenyl)thiophene-3-carboxamide (PubChem CID 30272266) has the molecular formula C13H11Cl2NO3S and a molecular weight of 332.21 g/mol. Its IUPAC name is 2,5-dichloro-N-(3,5-dimethoxyphenyl)thiophene-3-carboxamide.
| Compound Name | 2,5-dichloro-N-(3,5-dimethoxyphenyl)thiophene-3-carboxamide |
|---|---|
| PubChem CID | 30272266 |
| Molecular Formula | C13H11Cl2NO3S |
| Molecular Weight | 332.21 g/mol |
| Exact Mass | 330.98 |
| IUPAC Name | 2,5-dichloro-N-(3,5-dimethoxyphenyl)thiophene-3-carboxamide |
| SMILES | COc1cc(NC(=O)c2cc(Cl)sc2Cl)cc(OC)c1 |
| InChI | InChI=1S/C13H11Cl2NO3S/c1-18-8-3-7(4-9(5-8)19-2)16-13(17)10-6-11(14)20-12(10)15/h3-6H,1-2H3,(H,16,17) |
| InChIKey | RWLKAMAOSGFVRY-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.21 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |