C12H10Cl2N2OS — CID 113228330
N-(3-amino-4-methylphenyl)-2,5-dichlorothiophene-3-carboxamide (PubChem CID 113228330) has the molecular formula C12H10Cl2N2OS and a molecular weight of 301.20 g/mol. Its IUPAC name is N-(3-amino-4-methylphenyl)-2,5-dichlorothiophene-3-carboxamide.
| Compound Name | N-(3-amino-4-methylphenyl)-2,5-dichlorothiophene-3-carboxamide |
|---|---|
| PubChem CID | 113228330 |
| Molecular Formula | C12H10Cl2N2OS |
| Molecular Weight | 301.20 g/mol |
| Exact Mass | 299.99 |
| IUPAC Name | N-(3-amino-4-methylphenyl)-2,5-dichlorothiophene-3-carboxamide |
| SMILES | Cc1ccc(NC(=O)c2cc(Cl)sc2Cl)cc1N |
| InChI | InChI=1S/C12H10Cl2N2OS/c1-6-2-3-7(4-9(6)15)16-12(17)8-5-10(13)18-11(8)14/h2-5H,15H2,1H3,(H,16,17) |
| InChIKey | WZDJBAQKJIRTGZ-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.20 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|