C14H13F3N4O2 — CID 122298010
N-[2-(dimethylamino)pyrimidin-5-yl]-2,4,5-trifluoro-3-methoxybenzamide (PubChem CID 122298010) has the molecular formula C14H13F3N4O2 and a molecular weight of 326.28 g/mol. Its IUPAC name is N-[2-(dimethylamino)pyrimidin-5-yl]-2,4,5-trifluoro-3-methoxybenzamide.
| Compound Name | N-[2-(dimethylamino)pyrimidin-5-yl]-2,4,5-trifluoro-3-methoxybenzamide |
|---|---|
| PubChem CID | 122298010 |
| Molecular Formula | C14H13F3N4O2 |
| Molecular Weight | 326.28 g/mol |
| Exact Mass | 326.10 |
| IUPAC Name | N-[2-(dimethylamino)pyrimidin-5-yl]-2,4,5-trifluoro-3-methoxybenzamide |
| SMILES | COc1c(F)c(F)cc(C(=O)Nc2cnc(N(C)C)nc2)c1F |
| InChI | InChI=1S/C14H13F3N4O2/c1-21(2)14-18-5-7(6-19-14)20-13(22)8-4-9(15)11(17)12(23-3)10(8)16/h4-6H,1-3H3,(H,20,22) |
| InChIKey | YVCMMSGDRVUHTB-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.28 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|