C16H16F3N3O3 — CID 122356065
N-(2-ethoxy-4,6-dimethylpyrimidin-5-yl)-2,4,5-trifluoro-3-methoxybenzamide (PubChem CID 122356065) has the molecular formula C16H16F3N3O3 and a molecular weight of 355.32 g/mol. Its IUPAC name is N-(2-ethoxy-4,6-dimethylpyrimidin-5-yl)-2,4,5-trifluoro-3-methoxybenzamide.
| Compound Name | N-(2-ethoxy-4,6-dimethylpyrimidin-5-yl)-2,4,5-trifluoro-3-methoxybenzamide |
|---|---|
| PubChem CID | 122356065 |
| Molecular Formula | C16H16F3N3O3 |
| Molecular Weight | 355.32 g/mol |
| Exact Mass | 355.11 |
| IUPAC Name | N-(2-ethoxy-4,6-dimethylpyrimidin-5-yl)-2,4,5-trifluoro-3-methoxybenzamide |
| SMILES | CCOc1nc(C)c(NC(=O)c2cc(F)c(F)c(OC)c2F)c(C)n1 |
| InChI | InChI=1S/C16H16F3N3O3/c1-5-25-16-20-7(2)13(8(3)21-16)22-15(23)9-6-10(17)12(19)14(24-4)11(9)18/h6H,5H2,1-4H3,(H,22,23) |
| InChIKey | NIDXKSKGTCDROQ-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.32 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|