C15H15N5O6 — CID 122356187
N-(2-ethoxy-4,6-dimethylpyrimidin-5-yl)-3,5-dinitrobenzamide (PubChem CID 122356187) has the molecular formula C15H15N5O6 and a molecular weight of 361.31 g/mol. Its IUPAC name is N-(2-ethoxy-4,6-dimethylpyrimidin-5-yl)-3,5-dinitrobenzamide.
| Compound Name | N-(2-ethoxy-4,6-dimethylpyrimidin-5-yl)-3,5-dinitrobenzamide |
|---|---|
| PubChem CID | 122356187 |
| Molecular Formula | C15H15N5O6 |
| Molecular Weight | 361.31 g/mol |
| Exact Mass | 361.10 |
| IUPAC Name | N-(2-ethoxy-4,6-dimethylpyrimidin-5-yl)-3,5-dinitrobenzamide |
| SMILES | CCOc1nc(C)c(NC(=O)c2cc([N+](=O)[O-])cc([N+](=O)[O-])c2)c(C)n1 |
| InChI | InChI=1S/C15H15N5O6/c1-4-26-15-16-8(2)13(9(3)17-15)18-14(21)10-5-11(19(22)23)7-12(6-10)20(24)25/h5-7H,4H2,1-3H3,(H,18,21) |
| InChIKey | GFZDKWQEENCGMD-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 150.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.31 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|