C11H10ClN5O4 — CID 104817535
3-chloro-N-(3-ethoxy-1H-1,2,4-triazol-5-yl)-5-nitrobenzamide (PubChem CID 104817535) has the molecular formula C11H10ClN5O4 and a molecular weight of 311.69 g/mol. Its IUPAC name is 3-chloro-N-(3-ethoxy-1H-1,2,4-triazol-5-yl)-5-nitrobenzamide.
| Compound Name | 3-chloro-N-(3-ethoxy-1H-1,2,4-triazol-5-yl)-5-nitrobenzamide |
|---|---|
| PubChem CID | 104817535 |
| Molecular Formula | C11H10ClN5O4 |
| Molecular Weight | 311.69 g/mol |
| Exact Mass | 311.04 |
| IUPAC Name | 3-chloro-N-(3-ethoxy-1H-1,2,4-triazol-5-yl)-5-nitrobenzamide |
| SMILES | CCOc1n[nH]c(NC(=O)c2cc(Cl)cc([N+](=O)[O-])c2)n1 |
| InChI | InChI=1S/C11H10ClN5O4/c1-2-21-11-14-10(15-16-11)13-9(18)6-3-7(12)5-8(4-6)17(19)20/h3-5H,2H2,1H3,(H2,13,14,15,16,18) |
| InChIKey | RNAVVFUKHHDZJO-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 123.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.69 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|