C12H13N5O3 — CID 104818136
4-N-(3-ethoxy-1H-1,2,4-triazol-5-yl)benzene-1,4-dicarboxamide (PubChem CID 104818136) has the molecular formula C12H13N5O3 and a molecular weight of 275.27 g/mol. Its IUPAC name is 4-N-(3-ethoxy-1H-1,2,4-triazol-5-yl)benzene-1,4-dicarboxamide.
| Compound Name | 4-N-(3-ethoxy-1H-1,2,4-triazol-5-yl)benzene-1,4-dicarboxamide |
|---|---|
| PubChem CID | 104818136 |
| Molecular Formula | C12H13N5O3 |
| Molecular Weight | 275.27 g/mol |
| Exact Mass | 275.10 |
| IUPAC Name | 4-N-(3-ethoxy-1H-1,2,4-triazol-5-yl)benzene-1,4-dicarboxamide |
| SMILES | CCOc1n[nH]c(NC(=O)c2ccc(C(N)=O)cc2)n1 |
| InChI | InChI=1S/C12H13N5O3/c1-2-20-12-15-11(16-17-12)14-10(19)8-5-3-7(4-6-8)9(13)18/h3-6H,2H2,1H3,(H2,13,18)(H2,14,15,16,17,19) |
| InChIKey | KMSBBNWSYGNRRD-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 122.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.27 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |