C11H9F3N4O2 — CID 104818343
N-(3-ethoxy-1H-1,2,4-triazol-5-yl)-2,3,4-trifluorobenzamide (PubChem CID 104818343) has the molecular formula C11H9F3N4O2 and a molecular weight of 286.21 g/mol. Its IUPAC name is N-(3-ethoxy-1H-1,2,4-triazol-5-yl)-2,3,4-trifluorobenzamide.
| Compound Name | N-(3-ethoxy-1H-1,2,4-triazol-5-yl)-2,3,4-trifluorobenzamide |
|---|---|
| PubChem CID | 104818343 |
| Molecular Formula | C11H9F3N4O2 |
| Molecular Weight | 286.21 g/mol |
| Exact Mass | 286.07 |
| IUPAC Name | N-(3-ethoxy-1H-1,2,4-triazol-5-yl)-2,3,4-trifluorobenzamide |
| SMILES | CCOc1n[nH]c(NC(=O)c2ccc(F)c(F)c2F)n1 |
| InChI | InChI=1S/C11H9F3N4O2/c1-2-20-11-16-10(17-18-11)15-9(19)5-3-4-6(12)8(14)7(5)13/h3-4H,2H2,1H3,(H2,15,16,17,18,19) |
| InChIKey | SQOGPXUURHHHRI-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.21 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|