C9H9IN4O2S — CID 104818342
N-(3-ethoxy-1H-1,2,4-triazol-5-yl)-5-iodothiophene-3-carboxamide (PubChem CID 104818342) has the molecular formula C9H9IN4O2S and a molecular weight of 364.17 g/mol. Its IUPAC name is N-(3-ethoxy-1H-1,2,4-triazol-5-yl)-5-iodothiophene-3-carboxamide.
| Compound Name | N-(3-ethoxy-1H-1,2,4-triazol-5-yl)-5-iodothiophene-3-carboxamide |
|---|---|
| PubChem CID | 104818342 |
| Molecular Formula | C9H9IN4O2S |
| Molecular Weight | 364.17 g/mol |
| Exact Mass | 363.95 |
| IUPAC Name | N-(3-ethoxy-1H-1,2,4-triazol-5-yl)-5-iodothiophene-3-carboxamide |
| SMILES | CCOc1n[nH]c(NC(=O)c2csc(I)c2)n1 |
| InChI | InChI=1S/C9H9IN4O2S/c1-2-16-9-12-8(13-14-9)11-7(15)5-3-6(10)17-4-5/h3-4H,2H2,1H3,(H2,11,12,13,14,15) |
| InChIKey | QSJHEKUHCMHIST-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.17 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|