C15H16ClN3O2 — CID 122355868
3-chloro-N-(2-ethoxy-4,6-dimethylpyrimidin-5-yl)benzamide (PubChem CID 122355868) has the molecular formula C15H16ClN3O2 and a molecular weight of 305.77 g/mol. Its IUPAC name is 3-chloro-N-(2-ethoxy-4,6-dimethylpyrimidin-5-yl)benzamide.
| Compound Name | 3-chloro-N-(2-ethoxy-4,6-dimethylpyrimidin-5-yl)benzamide |
|---|---|
| PubChem CID | 122355868 |
| Molecular Formula | C15H16ClN3O2 |
| Molecular Weight | 305.77 g/mol |
| Exact Mass | 305.09 |
| IUPAC Name | 3-chloro-N-(2-ethoxy-4,6-dimethylpyrimidin-5-yl)benzamide |
| SMILES | CCOc1nc(C)c(NC(=O)c2cccc(Cl)c2)c(C)n1 |
| InChI | InChI=1S/C15H16ClN3O2/c1-4-21-15-17-9(2)13(10(3)18-15)19-14(20)11-6-5-7-12(16)8-11/h5-8H,4H2,1-3H3,(H,19,20) |
| InChIKey | GJVADNQBRASYJI-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.77 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |