C18H16F3N5O2 — CID 122300701
2,4,5-trifluoro-3-methoxy-N-[2-(3,4,5-trimethylpyrazol-1-yl)pyrimidin-5-yl]benzamide (PubChem CID 122300701) has the molecular formula C18H16F3N5O2 and a molecular weight of 391.35 g/mol. Its IUPAC name is 2,4,5-trifluoro-3-methoxy-N-[2-(3,4,5-trimethylpyrazol-1-yl)pyrimidin-5-yl]benzamide.
| Compound Name | 2,4,5-trifluoro-3-methoxy-N-[2-(3,4,5-trimethylpyrazol-1-yl)pyrimidin-5-yl]benzamide |
|---|---|
| PubChem CID | 122300701 |
| Molecular Formula | C18H16F3N5O2 |
| Molecular Weight | 391.35 g/mol |
| Exact Mass | 391.13 |
| IUPAC Name | 2,4,5-trifluoro-3-methoxy-N-[2-(3,4,5-trimethylpyrazol-1-yl)pyrimidin-5-yl]benzamide |
| SMILES | COc1c(F)c(F)cc(C(=O)Nc2cnc(-n3nc(C)c(C)c3C)nc2)c1F |
| InChI | InChI=1S/C18H16F3N5O2/c1-8-9(2)25-26(10(8)3)18-22-6-11(7-23-18)24-17(27)12-5-13(19)15(21)16(28-4)14(12)20/h5-7H,1-4H3,(H,24,27) |
| InChIKey | GRLCUSBONYMOTK-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.35 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|