About methyl 3-(dimethylamino)-2-(2,4,5-trifluoro-3-methoxybenzoyl)prop-2-enoate
methyl 3-(dimethylamino)-2-(2,4,5-trifluoro-3-methoxybenzoyl)prop-2-enoate (PubChem CID 139822873) has the molecular formula C14H14F3NO4
and a molecular weight of 317.26 g/mol. Its IUPAC name is methyl 3-(dimethylamino)-2-(2,4,5-trifluoro-3-methoxybenzoyl)prop-2-enoate.
Molecular Properties
| Compound Name | methyl 3-(dimethylamino)-2-(2,4,5-trifluoro-3-methoxybenzoyl)prop-2-enoate |
| PubChem CID | 139822873 |
| Molecular Formula | C14H14F3NO4 |
| Molecular Weight | 317.26 g/mol |
| Exact Mass | 317.09 |
| IUPAC Name | methyl 3-(dimethylamino)-2-(2,4,5-trifluoro-3-methoxybenzoyl)prop-2-enoate |
| SMILES | COC(=O)C(=CN(C)C)C(=O)c1cc(F)c(F)c(OC)c1F |
| InChI | InChI=1S/C14H14F3NO4/c1-18(2)6-8(14(20)22-4)12(19)7-5-9(15)11(17)13(21-3)10(7)16/h5-6H,1-4H3 |
| InChIKey | MBKYSLKBCPVOCJ-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.26 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|
Analyze methyl 3-(dimethylamino)-2-(2,4,5-trifluoro-3-methoxybenzoyl)prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-(dimethylamino)-2-(2,4,5-trifluoro-3-methoxybenzoyl)prop-2-enoate?
The IUPAC name of methyl 3-(dimethylamino)-2-(2,4,5-trifluoro-3-methoxybenzoyl)prop-2-enoate (CID 139822873) is methyl 3-(dimethylamino)-2-(2,4,5-trifluoro-3-methoxybenzoyl)prop-2-enoate.
What is the SMILES notation for methyl 3-(dimethylamino)-2-(2,4,5-trifluoro-3-methoxybenzoyl)prop-2-enoate?
The canonical SMILES for methyl 3-(dimethylamino)-2-(2,4,5-trifluoro-3-methoxybenzoyl)prop-2-enoate is COC(=O)C(=CN(C)C)C(=O)c1cc(F)c(F)c(OC)c1F.
What is the InChIKey of methyl 3-(dimethylamino)-2-(2,4,5-trifluoro-3-methoxybenzoyl)prop-2-enoate?
The InChIKey is MBKYSLKBCPVOCJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14F3NO4/c1-18(2)6-8(14(20)22-4)12(19)7-5-9(15)11(17)13(21-3)10(7)16/h5-6H,1-4H3.
What are the key properties of methyl 3-(dimethylamino)-2-(2,4,5-trifluoro-3-methoxybenzoyl)prop-2-enoate?
methyl 3-(dimethylamino)-2-(2,4,5-trifluoro-3-methoxybenzoyl)prop-2-enoate has a molecular weight of 317.26 g/mol, XLogP of 1.91, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-(dimethylamino)-2-(2,4,5-trifluoro-3-methoxybenzoyl)prop-2-enoate is sourced from PubChem (CID 139822873), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).