C17H19F3O5 — CID 175366104
ethyl 3-ethoxy-2-(2,4,5-trifluoro-3-methoxybenzoyl)pent-2-enoate (PubChem CID 175366104) has the molecular formula C17H19F3O5 and a molecular weight of 360.33 g/mol. Its IUPAC name is ethyl 3-ethoxy-2-(2,4,5-trifluoro-3-methoxybenzoyl)pent-2-enoate.
| Compound Name | ethyl 3-ethoxy-2-(2,4,5-trifluoro-3-methoxybenzoyl)pent-2-enoate |
|---|---|
| PubChem CID | 175366104 |
| Molecular Formula | C17H19F3O5 |
| Molecular Weight | 360.33 g/mol |
| Exact Mass | 360.12 |
| IUPAC Name | ethyl 3-ethoxy-2-(2,4,5-trifluoro-3-methoxybenzoyl)pent-2-enoate |
| SMILES | CCOC(=O)C(C(=O)c1cc(F)c(F)c(OC)c1F)=C(CC)OCC |
| InChI | InChI=1S/C17H19F3O5/c1-5-11(24-6-2)12(17(22)25-7-3)15(21)9-8-10(18)14(20)16(23-4)13(9)19/h8H,5-7H2,1-4H3 |
| InChIKey | MIYZNEOLCHPDOP-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.33 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|