C12H9F3O4 — CID 87347665
4-hydroxybut-2-ynyl 2,4,5-trifluoro-3-methoxybenzoate (PubChem CID 87347665) has the molecular formula C12H9F3O4 and a molecular weight of 274.19 g/mol. Its IUPAC name is 4-hydroxybut-2-ynyl 2,4,5-trifluoro-3-methoxybenzoate.
| Compound Name | 4-hydroxybut-2-ynyl 2,4,5-trifluoro-3-methoxybenzoate |
|---|---|
| PubChem CID | 87347665 |
| Molecular Formula | C12H9F3O4 |
| Molecular Weight | 274.19 g/mol |
| Exact Mass | 274.05 |
| IUPAC Name | 4-hydroxybut-2-ynyl 2,4,5-trifluoro-3-methoxybenzoate |
| SMILES | COc1c(F)c(F)cc(C(=O)OCC#CCO)c1F |
| InChI | InChI=1S/C12H9F3O4/c1-18-11-9(14)7(6-8(13)10(11)15)12(17)19-5-3-2-4-16/h6,16H,4-5H2,1H3 |
| InChIKey | MGBZGJZOBVRQII-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.19 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|