C14H13F3O6S — CID 141254579
4-methylsulfonyloxybut-2-ynyl 3-ethoxy-2,4,5-trifluorobenzoate (PubChem CID 141254579) has the molecular formula C14H13F3O6S and a molecular weight of 366.31 g/mol. Its IUPAC name is 4-methylsulfonyloxybut-2-ynyl 3-ethoxy-2,4,5-trifluorobenzoate.
| Compound Name | 4-methylsulfonyloxybut-2-ynyl 3-ethoxy-2,4,5-trifluorobenzoate |
|---|---|
| PubChem CID | 141254579 |
| Molecular Formula | C14H13F3O6S |
| Molecular Weight | 366.31 g/mol |
| Exact Mass | 366.04 |
| IUPAC Name | 4-methylsulfonyloxybut-2-ynyl 3-ethoxy-2,4,5-trifluorobenzoate |
| SMILES | CCOc1c(F)c(F)cc(C(=O)OCC#CCOS(C)(=O)=O)c1F |
| InChI | InChI=1S/C14H13F3O6S/c1-3-21-13-11(16)9(8-10(15)12(13)17)14(18)22-6-4-5-7-23-24(2,19)20/h8H,3,6-7H2,1-2H3 |
| InChIKey | YOPZUNPHXDUYSC-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.31 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|