C11H7F3O3 — CID 88858203
prop-2-ynyl 2,4,5-trifluoro-3-(hydroxymethyl)benzoate (PubChem CID 88858203) has the molecular formula C11H7F3O3 and a molecular weight of 244.17 g/mol. Its IUPAC name is prop-2-ynyl 2,4,5-trifluoro-3-(hydroxymethyl)benzoate.
| Compound Name | prop-2-ynyl 2,4,5-trifluoro-3-(hydroxymethyl)benzoate |
|---|---|
| PubChem CID | 88858203 |
| Molecular Formula | C11H7F3O3 |
| Molecular Weight | 244.17 g/mol |
| Exact Mass | 244.03 |
| IUPAC Name | prop-2-ynyl 2,4,5-trifluoro-3-(hydroxymethyl)benzoate |
| SMILES | C#CCOC(=O)c1cc(F)c(F)c(CO)c1F |
| InChI | InChI=1S/C11H7F3O3/c1-2-3-17-11(16)6-4-8(12)10(14)7(5-15)9(6)13/h1,4,15H,3,5H2 |
| InChIKey | RETWDJLZAGMBMH-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.17 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|