C10H5F3O2 — CID 59301763
prop-2-ynyl 3,4,5-trifluorobenzoate (PubChem CID 59301763) has the molecular formula C10H5F3O2 and a molecular weight of 214.14 g/mol. Its IUPAC name is prop-2-ynyl 3,4,5-trifluorobenzoate.
| Compound Name | prop-2-ynyl 3,4,5-trifluorobenzoate |
|---|---|
| PubChem CID | 59301763 |
| Molecular Formula | C10H5F3O2 |
| Molecular Weight | 214.14 g/mol |
| Exact Mass | 214.02 |
| IUPAC Name | prop-2-ynyl 3,4,5-trifluorobenzoate |
| SMILES | C#CCOC(=O)c1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C10H5F3O2/c1-2-3-15-10(14)6-4-7(11)9(13)8(12)5-6/h1,4-5H,3H2 |
| InChIKey | SODQAZFUODXHFZ-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.14 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|