C11H13F3O7S — CID 87347353
2-hydroxyethyl 2,4,5-trifluoro-3-methoxybenzoate;methanesulfonic acid (PubChem CID 87347353) has the molecular formula C11H13F3O7S and a molecular weight of 346.28 g/mol. Its IUPAC name is 2-hydroxyethyl 2,4,5-trifluoro-3-methoxybenzoate;methanesulfonic acid.
| Compound Name | 2-hydroxyethyl 2,4,5-trifluoro-3-methoxybenzoate;methanesulfonic acid |
|---|---|
| PubChem CID | 87347353 |
| Molecular Formula | C11H13F3O7S |
| Molecular Weight | 346.28 g/mol |
| Exact Mass | 346.03 |
| IUPAC Name | 2-hydroxyethyl 2,4,5-trifluoro-3-methoxybenzoate;methanesulfonic acid |
| SMILES | COc1c(F)c(F)cc(C(=O)OCCO)c1F.CS(=O)(=O)O |
| InChI | InChI=1S/C10H9F3O4.CH4O3S/c1-16-9-7(12)5(4-6(11)8(9)13)10(15)17-3-2-14;1-5(2,3)4/h4,14H,2-3H2,1H3;1H3,(H,2,3,4) |
| InChIKey | MREDLFFVVYMPOC-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.28 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|