C10H9ClF2O5S — CID 65374883
2-methoxyethyl 5-chlorosulfonyl-2,3-difluorobenzoate (PubChem CID 65374883) has the molecular formula C10H9ClF2O5S and a molecular weight of 314.69 g/mol. Its IUPAC name is 2-methoxyethyl 5-chlorosulfonyl-2,3-difluorobenzoate.
| Compound Name | 2-methoxyethyl 5-chlorosulfonyl-2,3-difluorobenzoate |
|---|---|
| PubChem CID | 65374883 |
| Molecular Formula | C10H9ClF2O5S |
| Molecular Weight | 314.69 g/mol |
| Exact Mass | 313.98 |
| IUPAC Name | 2-methoxyethyl 5-chlorosulfonyl-2,3-difluorobenzoate |
| SMILES | COCCOC(=O)c1cc(S(=O)(=O)Cl)cc(F)c1F |
| InChI | InChI=1S/C10H9ClF2O5S/c1-17-2-3-18-10(14)7-4-6(19(11,15)16)5-8(12)9(7)13/h4-5H,2-3H2,1H3 |
| InChIKey | BTGPTQVTBVLRAH-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.69 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|