About 2-methoxyethyl 2-chlorosulfonylbenzoate
2-methoxyethyl 2-chlorosulfonylbenzoate (PubChem CID 11572692) has the molecular formula C10H11ClO5S
and a molecular weight of 278.71 g/mol. Its IUPAC name is 2-methoxyethyl 2-chlorosulfonylbenzoate.
Molecular Properties
| Compound Name | 2-methoxyethyl 2-chlorosulfonylbenzoate |
| PubChem CID | 11572692 |
| Molecular Formula | C10H11ClO5S |
| Molecular Weight | 278.71 g/mol |
| Exact Mass | 278.00 |
| IUPAC Name | 2-methoxyethyl 2-chlorosulfonylbenzoate |
| SMILES | COCCOC(=O)c1ccccc1S(=O)(=O)Cl |
| InChI | InChI=1S/C10H11ClO5S/c1-15-6-7-16-10(12)8-4-2-3-5-9(8)17(11,13)14/h2-5H,6-7H2,1H3 |
| InChIKey | UBCBNFCUEQKNHY-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.71 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-methoxyethyl 2-chlorosulfonylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxyethyl 2-chlorosulfonylbenzoate?
The IUPAC name of 2-methoxyethyl 2-chlorosulfonylbenzoate (CID 11572692) is 2-methoxyethyl 2-chlorosulfonylbenzoate.
What is the SMILES notation for 2-methoxyethyl 2-chlorosulfonylbenzoate?
The canonical SMILES for 2-methoxyethyl 2-chlorosulfonylbenzoate is COCCOC(=O)c1ccccc1S(=O)(=O)Cl.
What is the InChIKey of 2-methoxyethyl 2-chlorosulfonylbenzoate?
The InChIKey is UBCBNFCUEQKNHY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11ClO5S/c1-15-6-7-16-10(12)8-4-2-3-5-9(8)17(11,13)14/h2-5H,6-7H2,1H3.
What are the key properties of 2-methoxyethyl 2-chlorosulfonylbenzoate?
2-methoxyethyl 2-chlorosulfonylbenzoate has a molecular weight of 278.71 g/mol, XLogP of 1.42, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxyethyl 2-chlorosulfonylbenzoate is sourced from PubChem (CID 11572692), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).