C13H16ClF2NO3S — CID 103465632
3-(2,2-dimethylbutylcarbamoyl)-4,5-difluorobenzenesulfonyl chloride (PubChem CID 103465632) has the molecular formula C13H16ClF2NO3S and a molecular weight of 339.79 g/mol. Its IUPAC name is 3-(2,2-dimethylbutylcarbamoyl)-4,5-difluorobenzenesulfonyl chloride.
| Compound Name | 3-(2,2-dimethylbutylcarbamoyl)-4,5-difluorobenzenesulfonyl chloride |
|---|---|
| PubChem CID | 103465632 |
| Molecular Formula | C13H16ClF2NO3S |
| Molecular Weight | 339.79 g/mol |
| Exact Mass | 339.05 |
| IUPAC Name | 3-(2,2-dimethylbutylcarbamoyl)-4,5-difluorobenzenesulfonyl chloride |
| SMILES | CCC(C)(C)CNC(=O)c1cc(S(=O)(=O)Cl)cc(F)c1F |
| InChI | InChI=1S/C13H16ClF2NO3S/c1-4-13(2,3)7-17-12(18)9-5-8(21(14,19)20)6-10(15)11(9)16/h5-6H,4,7H2,1-3H3,(H,17,18) |
| InChIKey | JBSYMLNBZZKGEW-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.79 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |