C7H2Cl2F2O3S — CID 116739963
5-chlorosulfonyl-2,3-difluorobenzoyl chloride (PubChem CID 116739963) has the molecular formula C7H2Cl2F2O3S and a molecular weight of 275.06 g/mol. Its IUPAC name is 5-chlorosulfonyl-2,3-difluorobenzoyl chloride.
| Compound Name | 5-chlorosulfonyl-2,3-difluorobenzoyl chloride |
|---|---|
| PubChem CID | 116739963 |
| Molecular Formula | C7H2Cl2F2O3S |
| Molecular Weight | 275.06 g/mol |
| Exact Mass | 273.91 |
| IUPAC Name | 5-chlorosulfonyl-2,3-difluorobenzoyl chloride |
| SMILES | O=C(Cl)c1cc(S(=O)(=O)Cl)cc(F)c1F |
| InChI | InChI=1S/C7H2Cl2F2O3S/c8-7(12)4-1-3(15(9,13)14)2-5(10)6(4)11/h1-2H |
| InChIKey | SXLDQHIYJVPZEJ-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.06 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|