C9H8Cl2O3S — CID 116739998
5-chlorosulfonyl-2,3-dimethylbenzoyl chloride (PubChem CID 116739998) has the molecular formula C9H8Cl2O3S and a molecular weight of 267.13 g/mol. Its IUPAC name is 5-chlorosulfonyl-2,3-dimethylbenzoyl chloride.
| Compound Name | 5-chlorosulfonyl-2,3-dimethylbenzoyl chloride |
|---|---|
| PubChem CID | 116739998 |
| Molecular Formula | C9H8Cl2O3S |
| Molecular Weight | 267.13 g/mol |
| Exact Mass | 265.96 |
| IUPAC Name | 5-chlorosulfonyl-2,3-dimethylbenzoyl chloride |
| SMILES | Cc1cc(S(=O)(=O)Cl)cc(C(=O)Cl)c1C |
| InChI | InChI=1S/C9H8Cl2O3S/c1-5-3-7(15(11,13)14)4-8(6(5)2)9(10)12/h3-4H,1-2H3 |
| InChIKey | RBCAQWHVQXXXRF-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.13 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|