C8H4ClF3O2 — CID 2775281
2,4,5-trifluoro-3-methoxybenzoyl chloride (PubChem CID 2775281) has the molecular formula C8H4ClF3O2 and a molecular weight of 224.56 g/mol. Its IUPAC name is 2,4,5-trifluoro-3-methoxybenzoyl chloride.
| Compound Name | 2,4,5-trifluoro-3-methoxybenzoyl chloride |
|---|---|
| PubChem CID | 2775281 |
| Molecular Formula | C8H4ClF3O2 |
| Molecular Weight | 224.56 g/mol |
| Exact Mass | 223.99 |
| IUPAC Name | 2,4,5-trifluoro-3-methoxybenzoyl chloride |
| SMILES | COc1c(F)c(F)cc(C(=O)Cl)c1F |
| InChI | InChI=1S/C8H4ClF3O2/c1-14-7-5(11)3(8(9)13)2-4(10)6(7)12/h2H,1H3 |
| InChIKey | JVQSZTJTWSUJCR-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.56 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|