2,4,5-trifluoro-3-methoxybenzoyl chloride

C8H4ClF3O2 — CID 2775281

IUPAC2,4,5-trifluoro-3-methoxybenzoyl chloride
SMILESCOc1c(F)c(F)cc(C(=O)Cl)c1F
InChIInChI=1S/C8H4ClF3O2/c1-14-7-5(11)3(8(9)13)2-4(10)6(7)12/h2H,1H3
InChIKeyJVQSZTJTWSUJCR-UHFFFAOYSA-N
MW224.56 g/mol
LogP2.49
Rot. Bonds2

About 2,4,5-trifluoro-3-methoxybenzoyl chloride

2,4,5-trifluoro-3-methoxybenzoyl chloride (PubChem CID 2775281) has the molecular formula C8H4ClF3O2 and a molecular weight of 224.56 g/mol. Its IUPAC name is 2,4,5-trifluoro-3-methoxybenzoyl chloride.

Molecular Properties

Compound Name2,4,5-trifluoro-3-methoxybenzoyl chloride
PubChem CID2775281
Molecular FormulaC8H4ClF3O2
Molecular Weight224.56 g/mol
Exact Mass223.99
IUPAC Name2,4,5-trifluoro-3-methoxybenzoyl chloride
SMILESCOc1c(F)c(F)cc(C(=O)Cl)c1F
InChIInChI=1S/C8H4ClF3O2/c1-14-7-5(11)3(8(9)13)2-4(10)6(7)12/h2H,1H3
InChIKeyJVQSZTJTWSUJCR-UHFFFAOYSA-N
XLogP2.49
TPSA26.30 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500224.56
LogP ≤ 52.49
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}

Analyze 2,4,5-trifluoro-3-methoxybenzoyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,4,5-trifluoro-3-methoxybenzoyl chloride?
The IUPAC name of 2,4,5-trifluoro-3-methoxybenzoyl chloride (CID 2775281) is 2,4,5-trifluoro-3-methoxybenzoyl chloride.
What is the SMILES notation for 2,4,5-trifluoro-3-methoxybenzoyl chloride?
The canonical SMILES for 2,4,5-trifluoro-3-methoxybenzoyl chloride is COc1c(F)c(F)cc(C(=O)Cl)c1F.
What is the InChIKey of 2,4,5-trifluoro-3-methoxybenzoyl chloride?
The InChIKey is JVQSZTJTWSUJCR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H4ClF3O2/c1-14-7-5(11)3(8(9)13)2-4(10)6(7)12/h2H,1H3.
What are the key properties of 2,4,5-trifluoro-3-methoxybenzoyl chloride?
2,4,5-trifluoro-3-methoxybenzoyl chloride has a molecular weight of 224.56 g/mol, XLogP of 2.49, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4,5-trifluoro-3-methoxybenzoyl chloride is sourced from PubChem (CID 2775281), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).