C17H18F3NO5 — CID 139822872
propyl 2-(3-acetyloxy-2,4,5-trifluorobenzoyl)-3-(dimethylamino)prop-2-enoate (PubChem CID 139822872) has the molecular formula C17H18F3NO5 and a molecular weight of 373.33 g/mol. Its IUPAC name is propyl 2-(3-acetyloxy-2,4,5-trifluorobenzoyl)-3-(dimethylamino)prop-2-enoate.
| Compound Name | propyl 2-(3-acetyloxy-2,4,5-trifluorobenzoyl)-3-(dimethylamino)prop-2-enoate |
|---|---|
| PubChem CID | 139822872 |
| Molecular Formula | C17H18F3NO5 |
| Molecular Weight | 373.33 g/mol |
| Exact Mass | 373.11 |
| IUPAC Name | propyl 2-(3-acetyloxy-2,4,5-trifluorobenzoyl)-3-(dimethylamino)prop-2-enoate |
| SMILES | CCCOC(=O)C(=CN(C)C)C(=O)c1cc(F)c(F)c(OC(C)=O)c1F |
| InChI | InChI=1S/C17H18F3NO5/c1-5-6-25-17(24)11(8-21(3)4)15(23)10-7-12(18)14(20)16(13(10)19)26-9(2)22/h7-8H,5-6H2,1-4H3 |
| InChIKey | QSLSOSHZQPRKFE-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.33 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|