About propyl 2-(3-acetyloxy-2,4,5-trifluorobenzoyl)-3-(dimethylamino)prop-2-enoate
propyl 2-(3-acetyloxy-2,4,5-trifluorobenzoyl)-3-(dimethylamino)prop-2-enoate (PubChem CID 139822872) has the molecular formula C17H18F3NO5
and a molecular weight of 373.33 g/mol. Its IUPAC name is propyl 2-(3-acetyloxy-2,4,5-trifluorobenzoyl)-3-(dimethylamino)prop-2-enoate.
Molecular Properties
| Compound Name | propyl 2-(3-acetyloxy-2,4,5-trifluorobenzoyl)-3-(dimethylamino)prop-2-enoate |
| PubChem CID | 139822872 |
| Molecular Formula | C17H18F3NO5 |
| Molecular Weight | 373.33 g/mol |
| Exact Mass | 373.11 |
| IUPAC Name | propyl 2-(3-acetyloxy-2,4,5-trifluorobenzoyl)-3-(dimethylamino)prop-2-enoate |
| SMILES | CCCOC(=O)C(=CN(C)C)C(=O)c1cc(F)c(F)c(OC(C)=O)c1F |
| InChI | InChI=1S/C17H18F3NO5/c1-5-6-25-17(24)11(8-21(3)4)15(23)10-7-12(18)14(20)16(13(10)19)26-9(2)22/h7-8H,5-6H2,1-4H3 |
| InChIKey | QSLSOSHZQPRKFE-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.33 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze propyl 2-(3-acetyloxy-2,4,5-trifluorobenzoyl)-3-(dimethylamino)prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propyl 2-(3-acetyloxy-2,4,5-trifluorobenzoyl)-3-(dimethylamino)prop-2-enoate?
The IUPAC name of propyl 2-(3-acetyloxy-2,4,5-trifluorobenzoyl)-3-(dimethylamino)prop-2-enoate (CID 139822872) is propyl 2-(3-acetyloxy-2,4,5-trifluorobenzoyl)-3-(dimethylamino)prop-2-enoate.
What is the SMILES notation for propyl 2-(3-acetyloxy-2,4,5-trifluorobenzoyl)-3-(dimethylamino)prop-2-enoate?
The canonical SMILES for propyl 2-(3-acetyloxy-2,4,5-trifluorobenzoyl)-3-(dimethylamino)prop-2-enoate is CCCOC(=O)C(=CN(C)C)C(=O)c1cc(F)c(F)c(OC(C)=O)c1F.
What is the InChIKey of propyl 2-(3-acetyloxy-2,4,5-trifluorobenzoyl)-3-(dimethylamino)prop-2-enoate?
The InChIKey is QSLSOSHZQPRKFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18F3NO5/c1-5-6-25-17(24)11(8-21(3)4)15(23)10-7-12(18)14(20)16(13(10)19)26-9(2)22/h7-8H,5-6H2,1-4H3.
What are the key properties of propyl 2-(3-acetyloxy-2,4,5-trifluorobenzoyl)-3-(dimethylamino)prop-2-enoate?
propyl 2-(3-acetyloxy-2,4,5-trifluorobenzoyl)-3-(dimethylamino)prop-2-enoate has a molecular weight of 373.33 g/mol, XLogP of 2.61, 7 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for propyl 2-(3-acetyloxy-2,4,5-trifluorobenzoyl)-3-(dimethylamino)prop-2-enoate is sourced from PubChem (CID 139822872), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).