C16H15F3O7 — CID 54155163
diethyl 2-(3-acetyloxy-2,4,5-trifluorobenzoyl)propanedioate (PubChem CID 54155163) has the molecular formula C16H15F3O7 and a molecular weight of 376.28 g/mol. Its IUPAC name is diethyl 2-(3-acetyloxy-2,4,5-trifluorobenzoyl)propanedioate.
| Compound Name | diethyl 2-(3-acetyloxy-2,4,5-trifluorobenzoyl)propanedioate |
|---|---|
| PubChem CID | 54155163 |
| Molecular Formula | C16H15F3O7 |
| Molecular Weight | 376.28 g/mol |
| Exact Mass | 376.08 |
| IUPAC Name | diethyl 2-(3-acetyloxy-2,4,5-trifluorobenzoyl)propanedioate |
| SMILES | CCOC(=O)C(C(=O)OCC)C(=O)c1cc(F)c(F)c(OC(C)=O)c1F |
| InChI | InChI=1S/C16H15F3O7/c1-4-24-15(22)10(16(23)25-5-2)13(21)8-6-9(17)12(19)14(11(8)18)26-7(3)20/h6,10H,4-5H2,1-3H3 |
| InChIKey | OKNODNUFPSMZAE-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.28 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|