C10H7F5O3 — CID 103288804
ethyl 2-fluoro-2-(2,3,5,6-tetrafluorophenoxy)acetate (PubChem CID 103288804) has the molecular formula C10H7F5O3 and a molecular weight of 270.15 g/mol. Its IUPAC name is ethyl 2-fluoro-2-(2,3,5,6-tetrafluorophenoxy)acetate.
| Compound Name | ethyl 2-fluoro-2-(2,3,5,6-tetrafluorophenoxy)acetate |
|---|---|
| PubChem CID | 103288804 |
| Molecular Formula | C10H7F5O3 |
| Molecular Weight | 270.15 g/mol |
| Exact Mass | 270.03 |
| IUPAC Name | ethyl 2-fluoro-2-(2,3,5,6-tetrafluorophenoxy)acetate |
| SMILES | CCOC(=O)C(F)Oc1c(F)c(F)cc(F)c1F |
| InChI | InChI=1S/C10H7F5O3/c1-2-17-10(16)9(15)18-8-6(13)4(11)3-5(12)7(8)14/h3,9H,2H2,1H3 |
| InChIKey | GVRZWNDFEBSGNH-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.15 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|