C10H6F4O5 — CID 59256880
3-methoxy-3-oxo-2-(2,3,5,6-tetrafluorophenoxy)propanoic acid (PubChem CID 59256880) has the molecular formula C10H6F4O5 and a molecular weight of 282.14 g/mol. Its IUPAC name is 3-methoxy-3-oxo-2-(2,3,5,6-tetrafluorophenoxy)propanoic acid.
| Compound Name | 3-methoxy-3-oxo-2-(2,3,5,6-tetrafluorophenoxy)propanoic acid |
|---|---|
| PubChem CID | 59256880 |
| Molecular Formula | C10H6F4O5 |
| Molecular Weight | 282.14 g/mol |
| Exact Mass | 282.02 |
| IUPAC Name | 3-methoxy-3-oxo-2-(2,3,5,6-tetrafluorophenoxy)propanoic acid |
| SMILES | COC(=O)C(Oc1c(F)c(F)cc(F)c1F)C(=O)O |
| InChI | InChI=1S/C10H6F4O5/c1-18-10(17)8(9(15)16)19-7-5(13)3(11)2-4(12)6(7)14/h2,8H,1H3,(H,15,16) |
| InChIKey | NBDDRBOVOYRGEL-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.14 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|