C9H7F4NO2 — CID 130143027
methyl 2-amino-2-(2,3,5,6-tetrafluorophenyl)acetate (PubChem CID 130143027) has the molecular formula C9H7F4NO2 and a molecular weight of 237.15 g/mol. Its IUPAC name is methyl 2-amino-2-(2,3,5,6-tetrafluorophenyl)acetate.
| Compound Name | methyl 2-amino-2-(2,3,5,6-tetrafluorophenyl)acetate |
|---|---|
| PubChem CID | 130143027 |
| Molecular Formula | C9H7F4NO2 |
| Molecular Weight | 237.15 g/mol |
| Exact Mass | 237.04 |
| IUPAC Name | methyl 2-amino-2-(2,3,5,6-tetrafluorophenyl)acetate |
| SMILES | COC(=O)C(N)c1c(F)c(F)cc(F)c1F |
| InChI | InChI=1S/C9H7F4NO2/c1-16-9(15)8(14)5-6(12)3(10)2-4(11)7(5)13/h2,8H,14H2,1H3 |
| InChIKey | VHYICBOKTOLCRG-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.15 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|