C9H8ClF4NO2 — CID 171230098
methyl (2R)-2-amino-2-(2,3,5,6-tetrafluorophenyl)acetate;hydrochloride (PubChem CID 171230098) has the molecular formula C9H8ClF4NO2 and a molecular weight of 273.61 g/mol. Its IUPAC name is methyl (2R)-2-amino-2-(2,3,5,6-tetrafluorophenyl)acetate;hydrochloride.
| Compound Name | methyl (2R)-2-amino-2-(2,3,5,6-tetrafluorophenyl)acetate;hydrochloride |
|---|---|
| PubChem CID | 171230098 |
| Molecular Formula | C9H8ClF4NO2 |
| Molecular Weight | 273.61 g/mol |
| Exact Mass | 273.02 |
| IUPAC Name | methyl (2R)-2-amino-2-(2,3,5,6-tetrafluorophenyl)acetate;hydrochloride |
| SMILES | COC(=O)[C@H](N)c1c(F)c(F)cc(F)c1F.Cl |
| InChI | InChI=1S/C9H7F4NO2.ClH/c1-16-9(15)8(14)5-6(12)3(10)2-4(11)7(5)13;/h2,8H,14H2,1H3;1H/t8-;/m1./s1 |
| InChIKey | OYRVEFHJWZQSGI-DDWIOCJRSA-N |
| XLogP | 1.84 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.61 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|