C9H9Cl2F2NO2 — CID 171228604
methyl (2R)-2-amino-2-(3-chloro-2,6-difluorophenyl)acetate;hydrochloride (PubChem CID 171228604) has the molecular formula C9H9Cl2F2NO2 and a molecular weight of 272.08 g/mol. Its IUPAC name is methyl (2R)-2-amino-2-(3-chloro-2,6-difluorophenyl)acetate;hydrochloride.
| Compound Name | methyl (2R)-2-amino-2-(3-chloro-2,6-difluorophenyl)acetate;hydrochloride |
|---|---|
| PubChem CID | 171228604 |
| Molecular Formula | C9H9Cl2F2NO2 |
| Molecular Weight | 272.08 g/mol |
| Exact Mass | 271.00 |
| IUPAC Name | methyl (2R)-2-amino-2-(3-chloro-2,6-difluorophenyl)acetate;hydrochloride |
| SMILES | COC(=O)[C@H](N)c1c(F)ccc(Cl)c1F.Cl |
| InChI | InChI=1S/C9H8ClF2NO2.ClH/c1-15-9(14)8(13)6-5(11)3-2-4(10)7(6)12;/h2-3,8H,13H2,1H3;1H/t8-;/m1./s1 |
| InChIKey | ZLXAIQCIBZKAHB-DDWIOCJRSA-N |
| XLogP | 2.21 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.08 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|