C9H8ClF2NO2 — CID 131624648
methyl (2R)-2-amino-2-(2-chloro-3,6-difluorophenyl)acetate (PubChem CID 131624648) has the molecular formula C9H8ClF2NO2 and a molecular weight of 235.62 g/mol. Its IUPAC name is methyl (2R)-2-amino-2-(2-chloro-3,6-difluorophenyl)acetate.
| Compound Name | methyl (2R)-2-amino-2-(2-chloro-3,6-difluorophenyl)acetate |
|---|---|
| PubChem CID | 131624648 |
| Molecular Formula | C9H8ClF2NO2 |
| Molecular Weight | 235.62 g/mol |
| Exact Mass | 235.02 |
| IUPAC Name | methyl (2R)-2-amino-2-(2-chloro-3,6-difluorophenyl)acetate |
| SMILES | COC(=O)[C@H](N)c1c(F)ccc(F)c1Cl |
| InChI | InChI=1S/C9H8ClF2NO2/c1-15-9(14)8(13)6-4(11)2-3-5(12)7(6)10/h2-3,8H,13H2,1H3/t8-/m1/s1 |
| InChIKey | JQDSNXHXFMFHCR-MRVPVSSYSA-N |
| XLogP | 1.79 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.62 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|