C10H11Cl3FNO2 — CID 171251582
methyl (3R)-3-amino-3-(3,6-dichloro-2-fluorophenyl)propanoate;hydrochloride (PubChem CID 171251582) has the molecular formula C10H11Cl3FNO2 and a molecular weight of 302.56 g/mol. Its IUPAC name is methyl (3R)-3-amino-3-(3,6-dichloro-2-fluorophenyl)propanoate;hydrochloride.
| Compound Name | methyl (3R)-3-amino-3-(3,6-dichloro-2-fluorophenyl)propanoate;hydrochloride |
|---|---|
| PubChem CID | 171251582 |
| Molecular Formula | C10H11Cl3FNO2 |
| Molecular Weight | 302.56 g/mol |
| Exact Mass | 300.98 |
| IUPAC Name | methyl (3R)-3-amino-3-(3,6-dichloro-2-fluorophenyl)propanoate;hydrochloride |
| SMILES | COC(=O)C[C@@H](N)c1c(Cl)ccc(Cl)c1F.Cl |
| InChI | InChI=1S/C10H10Cl2FNO2.ClH/c1-16-8(15)4-7(14)9-5(11)2-3-6(12)10(9)13;/h2-3,7H,4,14H2,1H3;1H/t7-;/m1./s1 |
| InChIKey | XZHBIIFNDZVVEF-OGFXRTJISA-N |
| XLogP | 3.12 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.56 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|