C9H10Cl3NO2 — CID 162344729
methyl 2-amino-2-(2,5-dichlorophenyl)acetate;hydrochloride (PubChem CID 162344729) has the molecular formula C9H10Cl3NO2 and a molecular weight of 270.54 g/mol. Its IUPAC name is methyl 2-amino-2-(2,5-dichlorophenyl)acetate;hydrochloride.
| Compound Name | methyl 2-amino-2-(2,5-dichlorophenyl)acetate;hydrochloride |
|---|---|
| PubChem CID | 162344729 |
| Molecular Formula | C9H10Cl3NO2 |
| Molecular Weight | 270.54 g/mol |
| Exact Mass | 268.98 |
| IUPAC Name | methyl 2-amino-2-(2,5-dichlorophenyl)acetate;hydrochloride |
| SMILES | COC(=O)C(N)c1cc(Cl)ccc1Cl.Cl |
| InChI | InChI=1S/C9H9Cl2NO2.ClH/c1-14-9(13)8(12)6-4-5(10)2-3-7(6)11;/h2-4,8H,12H2,1H3;1H |
| InChIKey | ZIEPCGBVXWIUMB-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.54 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |