C9H12ClNO5 — CID 171236695
methyl (2R)-2-amino-2-(2,4,6-trihydroxyphenyl)acetate;hydrochloride (PubChem CID 171236695) has the molecular formula C9H12ClNO5 and a molecular weight of 249.65 g/mol. Its IUPAC name is methyl (2R)-2-amino-2-(2,4,6-trihydroxyphenyl)acetate;hydrochloride.
| Compound Name | methyl (2R)-2-amino-2-(2,4,6-trihydroxyphenyl)acetate;hydrochloride |
|---|---|
| PubChem CID | 171236695 |
| Molecular Formula | C9H12ClNO5 |
| Molecular Weight | 249.65 g/mol |
| Exact Mass | 249.04 |
| IUPAC Name | methyl (2R)-2-amino-2-(2,4,6-trihydroxyphenyl)acetate;hydrochloride |
| SMILES | COC(=O)[C@H](N)c1c(O)cc(O)cc1O.Cl |
| InChI | InChI=1S/C9H11NO5.ClH/c1-15-9(14)8(10)7-5(12)2-4(11)3-6(7)13;/h2-3,8,11-13H,10H2,1H3;1H/t8-;/m1./s1 |
| InChIKey | NKKLDWODXWXWKE-DDWIOCJRSA-N |
| XLogP | 0.40 |
| TPSA | 113.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.65 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|