C9H10ClI2NO3 — CID 171235485
methyl (2R)-2-amino-2-(4-hydroxy-3,5-diiodophenyl)acetate;hydrochloride (PubChem CID 171235485) has the molecular formula C9H10ClI2NO3 and a molecular weight of 469.44 g/mol. Its IUPAC name is methyl (2R)-2-amino-2-(4-hydroxy-3,5-diiodophenyl)acetate;hydrochloride.
| Compound Name | methyl (2R)-2-amino-2-(4-hydroxy-3,5-diiodophenyl)acetate;hydrochloride |
|---|---|
| PubChem CID | 171235485 |
| Molecular Formula | C9H10ClI2NO3 |
| Molecular Weight | 469.44 g/mol |
| Exact Mass | 468.84 |
| IUPAC Name | methyl (2R)-2-amino-2-(4-hydroxy-3,5-diiodophenyl)acetate;hydrochloride |
| SMILES | COC(=O)[C@H](N)c1cc(I)c(O)c(I)c1.Cl |
| InChI | InChI=1S/C9H9I2NO3.ClH/c1-15-9(14)7(12)4-2-5(10)8(13)6(11)3-4;/h2-3,7,13H,12H2,1H3;1H/t7-;/m1./s1 |
| InChIKey | HTWYJAAMVNMZPO-OGFXRTJISA-N |
| XLogP | 2.20 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.44 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|