C11H15NO3 — CID 60796972
methyl 2-amino-2-(4-hydroxy-3,5-dimethylphenyl)acetate (PubChem CID 60796972) has the molecular formula C11H15NO3 and a molecular weight of 209.24 g/mol. Its IUPAC name is methyl 2-amino-2-(4-hydroxy-3,5-dimethylphenyl)acetate.
| Compound Name | methyl 2-amino-2-(4-hydroxy-3,5-dimethylphenyl)acetate |
|---|---|
| PubChem CID | 60796972 |
| Molecular Formula | C11H15NO3 |
| Molecular Weight | 209.24 g/mol |
| Exact Mass | 209.11 |
| IUPAC Name | methyl 2-amino-2-(4-hydroxy-3,5-dimethylphenyl)acetate |
| SMILES | COC(=O)C(N)c1cc(C)c(O)c(C)c1 |
| InChI | InChI=1S/C11H15NO3/c1-6-4-8(5-7(2)10(6)13)9(12)11(14)15-3/h4-5,9,13H,12H2,1-3H3 |
| InChIKey | VSLJXBAAQCDZDY-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.24 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |