C10H13Cl2NO4 — CID 171215382
methyl (2S)-2-amino-2-(3-chloro-4-hydroxy-5-methoxyphenyl)acetate;hydrochloride (PubChem CID 171215382) has the molecular formula C10H13Cl2NO4 and a molecular weight of 282.12 g/mol. Its IUPAC name is methyl (2S)-2-amino-2-(3-chloro-4-hydroxy-5-methoxyphenyl)acetate;hydrochloride.
| Compound Name | methyl (2S)-2-amino-2-(3-chloro-4-hydroxy-5-methoxyphenyl)acetate;hydrochloride |
|---|---|
| PubChem CID | 171215382 |
| Molecular Formula | C10H13Cl2NO4 |
| Molecular Weight | 282.12 g/mol |
| Exact Mass | 281.02 |
| IUPAC Name | methyl (2S)-2-amino-2-(3-chloro-4-hydroxy-5-methoxyphenyl)acetate;hydrochloride |
| SMILES | COC(=O)[C@@H](N)c1cc(Cl)c(O)c(OC)c1.Cl |
| InChI | InChI=1S/C10H12ClNO4.ClH/c1-15-7-4-5(3-6(11)9(7)13)8(12)10(14)16-2;/h3-4,8,13H,12H2,1-2H3;1H/t8-;/m0./s1 |
| InChIKey | OWWJDGHTCLIYMN-QRPNPIFTSA-N |
| XLogP | 1.65 |
| TPSA | 81.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.12 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |