(2R)-2-amino-2-(4-hydroxy-3,5-dimethoxyphenyl)acetic acid

C10H13NO5 — CID 124634776

IUPAC(2R)-2-amino-2-(4-hydroxy-3,5-dimethoxyphenyl)acetic acid
SMILESCOc1cc([C@@H](N)C(=O)O)cc(OC)c1O
InChIInChI=1S/C10H13NO5/c1-15-6-3-5(8(11)10(13)14)4-7(16-2)9(6)12/h3-4,8,12H,11H2,1-2H3,(H,13,14)/t8-/m1/s1
InChIKeyUUXHEICYDHHALP-MRVPVSSYSA-N
MW227.22 g/mol
LogP0.49
Rot. Bonds4

About (2R)-2-amino-2-(4-hydroxy-3,5-dimethoxyphenyl)acetic acid

(2R)-2-amino-2-(4-hydroxy-3,5-dimethoxyphenyl)acetic acid (PubChem CID 124634776) has the molecular formula C10H13NO5 and a molecular weight of 227.22 g/mol. Its IUPAC name is (2R)-2-amino-2-(4-hydroxy-3,5-dimethoxyphenyl)acetic acid.

Molecular Properties

Compound Name(2R)-2-amino-2-(4-hydroxy-3,5-dimethoxyphenyl)acetic acid
PubChem CID124634776
Molecular FormulaC10H13NO5
Molecular Weight227.22 g/mol
Exact Mass227.08
IUPAC Name(2R)-2-amino-2-(4-hydroxy-3,5-dimethoxyphenyl)acetic acid
SMILESCOc1cc([C@@H](N)C(=O)O)cc(OC)c1O
InChIInChI=1S/C10H13NO5/c1-15-6-3-5(8(11)10(13)14)4-7(16-2)9(6)12/h3-4,8,12H,11H2,1-2H3,(H,13,14)/t8-/m1/s1
InChIKeyUUXHEICYDHHALP-MRVPVSSYSA-N
XLogP0.49
TPSA102.01 Ų
H-Bond Donors3
H-Bond Acceptors5
Rotatable Bonds4
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500227.22
LogP ≤ 50.49
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 105

Analyze (2R)-2-amino-2-(4-hydroxy-3,5-dimethoxyphenyl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2R)-2-amino-2-(4-hydroxy-3,5-dimethoxyphenyl)acetic acid?
The IUPAC name of (2R)-2-amino-2-(4-hydroxy-3,5-dimethoxyphenyl)acetic acid (CID 124634776) is (2R)-2-amino-2-(4-hydroxy-3,5-dimethoxyphenyl)acetic acid.
What is the SMILES notation for (2R)-2-amino-2-(4-hydroxy-3,5-dimethoxyphenyl)acetic acid?
The canonical SMILES for (2R)-2-amino-2-(4-hydroxy-3,5-dimethoxyphenyl)acetic acid is COc1cc([C@@H](N)C(=O)O)cc(OC)c1O.
What is the InChIKey of (2R)-2-amino-2-(4-hydroxy-3,5-dimethoxyphenyl)acetic acid?
The InChIKey is UUXHEICYDHHALP-MRVPVSSYSA-N. The full InChI is InChI=1S/C10H13NO5/c1-15-6-3-5(8(11)10(13)14)4-7(16-2)9(6)12/h3-4,8,12H,11H2,1-2H3,(H,13,14)/t8-/m1/s1.
What are the key properties of (2R)-2-amino-2-(4-hydroxy-3,5-dimethoxyphenyl)acetic acid?
(2R)-2-amino-2-(4-hydroxy-3,5-dimethoxyphenyl)acetic acid has a molecular weight of 227.22 g/mol, XLogP of 0.49, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-amino-2-(4-hydroxy-3,5-dimethoxyphenyl)acetic acid is sourced from PubChem (CID 124634776), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).