C8H9ClFI2NO — CID 171215816
4-[(1S)-1-amino-2-fluoroethyl]-2,6-diiodophenol;hydrochloride (PubChem CID 171215816) has the molecular formula C8H9ClFI2NO and a molecular weight of 443.43 g/mol. Its IUPAC name is 4-[(1S)-1-amino-2-fluoroethyl]-2,6-diiodophenol;hydrochloride.
| Compound Name | 4-[(1S)-1-amino-2-fluoroethyl]-2,6-diiodophenol;hydrochloride |
|---|---|
| PubChem CID | 171215816 |
| Molecular Formula | C8H9ClFI2NO |
| Molecular Weight | 443.43 g/mol |
| Exact Mass | 442.84 |
| IUPAC Name | 4-[(1S)-1-amino-2-fluoroethyl]-2,6-diiodophenol;hydrochloride |
| SMILES | Cl.N[C@H](CF)c1cc(I)c(O)c(I)c1 |
| InChI | InChI=1S/C8H8FI2NO.ClH/c9-3-7(12)4-1-5(10)8(13)6(11)2-4;/h1-2,7,13H,3,12H2;1H/t7-;/m1./s1 |
| InChIKey | RBPWGURRZXUFCM-OGFXRTJISA-N |
| XLogP | 2.99 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.43 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|