C10H11I2NO — CID 130731072
4-[(1S)-1-aminobut-3-enyl]-2,6-diiodophenol (PubChem CID 130731072) has the molecular formula C10H11I2NO and a molecular weight of 415.01 g/mol. Its IUPAC name is 4-[(1S)-1-aminobut-3-enyl]-2,6-diiodophenol.
| Compound Name | 4-[(1S)-1-aminobut-3-enyl]-2,6-diiodophenol |
|---|---|
| PubChem CID | 130731072 |
| Molecular Formula | C10H11I2NO |
| Molecular Weight | 415.01 g/mol |
| Exact Mass | 414.89 |
| IUPAC Name | 4-[(1S)-1-aminobut-3-enyl]-2,6-diiodophenol |
| SMILES | C=CC[C@H](N)c1cc(I)c(O)c(I)c1 |
| InChI | InChI=1S/C10H11I2NO/c1-2-3-9(13)6-4-7(11)10(14)8(12)5-6/h2,4-5,9,14H,1,3,13H2/t9-/m0/s1 |
| InChIKey | QJFCKMDRSJIMSL-VIFPVBQESA-N |
| XLogP | 3.18 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.01 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|