C10H12Cl2N2 — CID 131172310
4-[(1R)-1-aminobut-3-enyl]-2,6-dichloroaniline (PubChem CID 131172310) has the molecular formula C10H12Cl2N2 and a molecular weight of 231.13 g/mol. Its IUPAC name is 4-[(1R)-1-aminobut-3-enyl]-2,6-dichloroaniline.
| Compound Name | 4-[(1R)-1-aminobut-3-enyl]-2,6-dichloroaniline |
|---|---|
| PubChem CID | 131172310 |
| Molecular Formula | C10H12Cl2N2 |
| Molecular Weight | 231.13 g/mol |
| Exact Mass | 230.04 |
| IUPAC Name | 4-[(1R)-1-aminobut-3-enyl]-2,6-dichloroaniline |
| SMILES | C=CC[C@@H](N)c1cc(Cl)c(N)c(Cl)c1 |
| InChI | InChI=1S/C10H12Cl2N2/c1-2-3-9(13)6-4-7(11)10(14)8(12)5-6/h2,4-5,9H,1,3,13-14H2/t9-/m1/s1 |
| InChIKey | YZOOJTSVURYEHO-SECBINFHSA-N |
| XLogP | 3.15 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.13 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|