C10H11Br2N — CID 103693293
1-(3,5-dibromophenyl)but-3-en-1-amine (PubChem CID 103693293) has the molecular formula C10H11Br2N and a molecular weight of 305.01 g/mol. Its IUPAC name is 1-(3,5-dibromophenyl)but-3-en-1-amine.
| Compound Name | 1-(3,5-dibromophenyl)but-3-en-1-amine |
|---|---|
| PubChem CID | 103693293 |
| Molecular Formula | C10H11Br2N |
| Molecular Weight | 305.01 g/mol |
| Exact Mass | 302.93 |
| IUPAC Name | 1-(3,5-dibromophenyl)but-3-en-1-amine |
| SMILES | C=CCC(N)c1cc(Br)cc(Br)c1 |
| InChI | InChI=1S/C10H11Br2N/c1-2-3-10(13)7-4-8(11)6-9(12)5-7/h2,4-6,10H,1,3,13H2 |
| InChIKey | XIAZQLFTUQWNEN-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.01 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|