C10H12Br2N2 — CID 107978932
1-(3,5-dibromophenyl)but-3-enylhydrazine (PubChem CID 107978932) has the molecular formula C10H12Br2N2 and a molecular weight of 320.03 g/mol. Its IUPAC name is 1-(3,5-dibromophenyl)but-3-enylhydrazine.
| Compound Name | 1-(3,5-dibromophenyl)but-3-enylhydrazine |
|---|---|
| PubChem CID | 107978932 |
| Molecular Formula | C10H12Br2N2 |
| Molecular Weight | 320.03 g/mol |
| Exact Mass | 317.94 |
| IUPAC Name | 1-(3,5-dibromophenyl)but-3-enylhydrazine |
| SMILES | C=CCC(NN)c1cc(Br)cc(Br)c1 |
| InChI | InChI=1S/C10H12Br2N2/c1-2-3-10(14-13)7-4-8(11)6-9(12)5-7/h2,4-6,10,14H,1,3,13H2 |
| InChIKey | PJTATNUOJHMBOR-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.03 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|